
69739-34-0
| Name | Trifluoromethanesulfonic acid tert-butyldimethylsilyl ester |
| CAS | 69739-34-0 |
| EINECS(EC#) | 274-102-0 |
| Molecular Formula | C7H15F3O3SSi |
| MDL Number | MFCD00000405 |
| Molecular Weight | 264.34 |
| MOL File | 69739-34-0.mol |
Chemical Properties
| Appearance | clear colorless to yellow fuming liquid |
| Melting point | <0°C |
| Boiling point | 65-67 °C12 mm Hg(lit.) |
| density | 1.151 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 98 °F |
| storage temp. | 2-8°C |
| solubility | Slightly miscible with chloroform. |
| form | Fuming Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.151 |
| Water Solubility | DECOMPOSES |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 2370068 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C7H15F3O3SSi/c1-6(2,3)15(4,5)13-14(11,12)7(8,9)10/h1-5H3 |
| InChIKey | WLLIXJBWWFGEHT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H314-H335 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Flammable/Corrosive |
| TSCA | No |
| REACH Registrations | Active |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B STOT SE 3 |


