
696-02-6
| Name | 1-Chloro-3,4-difluorobenzene |
| CAS | 696-02-6 |
| EINECS(EC#) | 614-988-1 |
| Molecular Formula | C6H3ClF2 |
| MDL Number | MFCD00042572 |
| Molecular Weight | 148.54 |
| MOL File | 696-02-6.mol |
Chemical Properties
| Appearance | Clear colourless to light yellow liquid |
| Boiling point | 126 °C (lit.) |
| density | 1.33 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 96 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| BRN | 2081081 |
| InChI | InChI=1S/C6H3ClF2/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | OPQMRQYYRSTBME-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 696-02-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Chloro-3,4-difluorobenzene(696-02-6) |
Safety Data
| Hazard Codes | Xn,F,Xi,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |