6933-10-4
| Name | 4-Bromo-3-methylaniline |
| CAS | 6933-10-4 |
| EINECS(EC#) | 230-056-3 |
| Molecular Formula | C7H8BrN |
| MDL Number | MFCD00007828 |
| Molecular Weight | 186.05 |
| MOL File | 6933-10-4.mol |
Chemical Properties
| Appearance | grey to brownish crystalline powder |
| Melting point | 80-82 °C (lit.) |
| Boiling point | 240 °C (lit.) |
| density | 1.4700 (rough estimate) |
| refractive index | 1.6190 (estimate) |
| Fp | 239-241°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| pka | 4.02±0.10(Predicted) |
| color | Off-white to beige to light brown |
| BRN | 2689600 |
| InChI | InChI=1S/C7H8BrN/c1-5-4-6(9)2-3-7(5)8/h2-4H,9H2,1H3 |
| InChIKey | MMEGELSFOYDPQW-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C(C)=C1 |
| CAS DataBase Reference | 6933-10-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-bromo-3-methyl-(6933-10-4) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921420090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
