68988-92-1
| Name | Wright's stain |
| CAS | 68988-92-1 |
| EINECS(EC#) | 273-541-5 |
| Molecular Formula | C36H27N3O5Br4S |
| MDL Number | MFCD00082143 |
| Molecular Weight | 933.298 |
| MOL File | 68988-92-1.mol |
Chemical Properties
| Appearance | dark green crystalline powder |
| Melting point | -98°C |
| Boiling point | 65°C |
| density | 0.8 |
| vapor density | 3.17 (vs air) |
| vapor pressure | 97.68 mm of Hg (@ 20°C) |
| refractive index | 1.52-1.522 |
| Fp | 11°C |
| storage temp. | Store at +15°C to +30°C. |
| solubility | methanol: soluble10mg/10 mL |
| form | Solid |
| color | Dark green |
| Odor | Dark blue |
| explosive limit | 6-36.50% |
| Water Solubility | Easily soluble in cold water |
| λmax | 520-530 nm (Eosin) 645-655 nm (Azure) |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | AXIKDPDWFVPGOD-UHFFFAOYSA-O |
| SMILES | [s]5c6c(nc7c5cc(cc7)N(C)C)cc[c](c6)=[N+](C)C.Brc1c2[o+]c3c(c(c2cc(c1O)Br)c4c(cccc4)C(=O)O)cc(c(c3Br)O)Br |
Safety Data
| Hazard Codes | Xn,T,F,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Autoignition Temperature | 393°C |
| TSCA | Yes |
| PackingGroup | II |
| HS Code | 32041900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |