
67747-09-5
| Name | Prochloraz |
| CAS | 67747-09-5 |
| EINECS(EC#) | 266-994-5 |
| Molecular Formula | C15H16Cl3N3O2 |
| MDL Number | MFCD00078735 |
| Molecular Weight | 376.67 |
| MOL File | 67747-09-5.mol |
Chemical Properties
| Melting point | 46-49°C |
| Boiling point | 360℃ |
| density | 1.405 |
| vapor pressure | 1.5 x l0-4 Pa (25 °C) |
| refractive index | 1.6490 (estimate) |
| Fp | 2 °C |
| storage temp. | 0-6°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS(pH 7.2) (1:1): 0.5 mg/ml |
| form | neat |
| pka | 3.8 (weak base) |
| Water Solubility | 34.4 mg l-1 (25 °C) |
| color | White to Light yellow to Light orange |
| Merck | 13,7849 |
| BRN | 8155344 |
| Henry's Law Constant | 6.0×102 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Major Application | agriculture environmental |
| InChI | 1S/C15H16Cl3N3O2/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18/h3,5,8-10H,2,4,6-7H2,1H3 |
| InChIKey | TVLSRXXIMLFWEO-UHFFFAOYSA-N |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)n2ccnc2 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P301+P312+P330 |
| Hazard Codes | Xn;N,N,Xn,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | NI4000400 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |


