
67719-69-1
| Name | TEBBE REAGENT |
| CAS | 67719-69-1 |
| Molecular Formula | C13H18AlClTi 10* |
| MDL Number | MFCD00151575 |
| Molecular Weight | 284.58 |
| MOL File | 67719-69-1.mol |
Chemical Properties
| Appearance | Dark red to purple solution |
| density | 0.96 g/mL at 20 °C |
| Fp | 34 °F |
| storage temp. | Refrigerator |
| form | Solution |
| color | Dark red to purple |
| Water Solubility | Soluble in toluene, benzene, dichloromethane. Insoluble in water. |
| Sensitive | Air & Moisture Sensitive |
| Merck | 9091 |
| Exposure limits | ACGIH: TWA 20 ppm OSHA: Ceiling 300 ppm; TWA 200 ppm NIOSH: IDLH 500 ppm; TWA 100 ppm(375 mg/m3); STEL 150 ppm(560 mg/m3) |
| InChI | InChI=1S/2C5.2CH2.C.Al.ClH.Ti/c2*1-2-4-5-3-1;;;;;;/h;;2*1H2;;;1H;/q4*-1;-2;+3;;+4/p-1 |
| InChIKey | QEJAQNUJXFLWSP-UHFFFAOYSA-M |
| SMILES | [CH2-][Al+3]1([Cl-][Ti+4]23456789(C%10[C-]2C3=C4C5=%10)(C2[C-]6C7=C8C9=2)[C-2]1)[CH2-] |
Safety Data
| Hazard Codes | F,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 2 |
| F | 1-10 |
| HazardClass | 4.3 |
| PackingGroup | II |
| HS Code | 29310099 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Eye Dam. 1 Flam. Liq. 2 Repr. 2 Skin Corr. 1B STOT RE 2 STOT SE 3 |