
67129-08-2
| Name | Metazachlor |
| CAS | 67129-08-2 |
| EINECS(EC#) | 266-583-0 |
| Molecular Formula | C14H16ClN3O |
| MDL Number | MFCD00055509 |
| Molecular Weight | 277.75 |
| MOL File | 67129-08-2.mol |
Chemical Properties
| Melting point | 74-78°C |
| Boiling point | 439.2±45.0 °C(Predicted) |
| density | 1.237-1.323 g/cm3(Temp: 25 °C) |
| Fp | 2 °C |
| storage temp. | APPROX 4°C |
| solubility | Chloroform, Methanol |
| form | neat |
| pka | 1.54±0.10(Predicted) |
| color | Off-White to Pale Beige |
| BRN | 621550 |
| Henry's Law Constant | 1.3×101 mol/(m3Pa) at 25℃, Barcelo and Hennion (1997) |
| Major Application | agriculture environmental |
| InChI | 1S/C14H16ClN3O/c1-11-5-3-6-12(2)14(11)18(13(19)9-15)10-17-8-4-7-16-17/h3-8H,9-10H2,1-2H3 |
| InChIKey | STEPQTYSZVCJPV-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1N(Cn2cccn2)C(=O)CCl |
| LogP | 2.130 |
| CAS DataBase Reference | 67129-08-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetamide, 2-chloro-n-(2,6-dimethylphenyl)-n-(1h-pyrazol-1-ylmethyl)-(67129-08-2) |
Safety Data
| Hazard Codes | Xn,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| RTECS | AB5442000 |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Skin Sens. 1 |