67004-64-2
| Name | 1-Methyl-2-pyrrolidineethanol |
| CAS | 67004-64-2 |
| EINECS(EC#) | 266-538-5 |
| Molecular Formula | C7H15NO |
| MDL Number | MFCD00003174 |
| Molecular Weight | 129.2 |
| MOL File | 67004-64-2.mol |
Chemical Properties
| Appearance | clear yellow to brownish liquid |
| Boiling point | 110-112 °C14 mm Hg(lit.) |
| density | 0.951 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 184 °F |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| form | clear liquid |
| pka | 15.03±0.10(Predicted) |
| color | Colorless to Red to Green |
| InChI | InChI=1S/C7H15NO/c1-8-5-2-3-7(8)4-6-9/h7,9H,2-6H2,1H3 |
| InChIKey | FYVMBPXFPFAECB-UHFFFAOYSA-N |
| SMILES | N1(C)CCCC1CCO |
| CAS DataBase Reference | 67004-64-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 |
