
6575-00-4
| Name | 3,5-Dichlorobenzonitrile |
| CAS | 6575-00-4 |
| EINECS(EC#) | 229-495-3 |
| Molecular Formula | C7H3Cl2N |
| MDL Number | MFCD00001800 |
| Molecular Weight | 172.01 |
| MOL File | 6575-00-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 64-66 °C (lit.) |
| Boiling point | 283.76°C (rough estimate) |
| density | 1.4980 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to beige-brownish |
| BRN | 2207019 |
| InChI | InChI=1S/C7H3Cl2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
| InChIKey | PUJSUOGJGIECFQ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(Cl)=CC(Cl)=C1 |
| CAS DataBase Reference | 6575-00-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dichlorobenzonitrile(6575-00-4) |
Safety Data
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Toxic |
| TSCA | N |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |