65646-68-6
| Name | 4-HYDROXYPHENYLRETINAMIDE |
| CAS | 65646-68-6 |
| EINECS(EC#) | 200-256-5 |
| Molecular Formula | C26H33NO2 |
| MDL Number | MFCD00792674 |
| Molecular Weight | 391.55 |
| MOL File | 65646-68-6.mol |
Chemical Properties
| Appearance | Yellow Powder |
| Melting point | 162-163°C |
| Boiling point | 597.6±42.0 °C(Predicted) |
| density | 1.081±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Orange solid |
| pka | 9.98±0.26(Predicted) |
| color | Yellow |
| biological source | synthetic (organic) |
| Usage | An effective agent for the chemoprevention and growth modulation of oncogene-induced prostate cancer in the mouse prostate reconstitution model system and may be effective for the chemoprevention of human prostate cancer |
| λmax | 362nm(MeOH)(lit.) |
| Merck | 14,3998 |
| Stability: | Light Sensitive - Protect from Light Exposure |
| InChIKey | AKJHMTWEGVYYSE-FXILSDISSA-N |
| SMILES | C(NC1=CC=C(O)C=C1)(=O)/C=C(/C=C/C=C(/C=C/C1C(C)(C)CCCC=1C)\C)\C |
| CAS DataBase Reference | 65646-68-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VH6420000 |
| HS Code | 2924297099 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT SE 3 |