
64-72-2
| Name | Chlortetracycline hydrochloride |
| CAS | 64-72-2 |
| EINECS(EC#) | 200-591-7 |
| Molecular Formula | C22H24Cl2N2O8 |
| MDL Number | MFCD00082440 |
| Molecular Weight | 515.34 |
| MOL File | 64-72-2.mol |
Chemical Properties
| Appearance | Yellow Solid |
| Melting point | 210-215 °C (dec.)(lit.) |
| alpha | D23 -240° |
| storage temp. | 2-8°C |
| solubility | 1 M NaOH: soluble50mg/mL |
| form | Powder |
| color | faint yellow to yellow |
| pka | 3.3(at 25℃) |
| biological source | Streptomyces aureofaciens |
| Water Solubility | Soluble in water |
| Sensitive | Light Sensitive |
| Usage | An antimicrobial and antibacterial. This compound contains an undetermined amount of epi-chlortetracycline |
| Merck | 13,2211 |
| BRN | 3858364 |
| Major Application | cleaning products clinical cosmetics environmental food and beverages forensics and toxicology personal care pharmaceutical (small molecule) |
| InChIKey | CBHYYLPALVVVEY-BXDNGZFMNA-N |
| SMILES | O[C@@]12C(C(C(=O)N)=C(O)[C@@H](N(C)C)[C@]1([H])C[C@]1([H])[C@@](C3C(=CC=C(O)C=3C(=O)C1=C2O)Cl)(O)C)=O.Cl |&1:1,9,13,16,18,r| |
| CAS DataBase Reference | 64-72-2(CAS DataBase Reference) |
| EPA Substance Registry System | 64-72-2(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335-H361fd |
| Precautionary statements | P202-P261-P280-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | QI7800000 |
| HazardClass | 3 |
| HS Code | 29413020 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Repr. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity |

