
6388-47-2
| Name | 2-Amino-3-chlorobenzoic acid |
| CAS | 6388-47-2 |
| EINECS(EC#) | 228-996-4 |
| Molecular Formula | C7H6ClNO2 |
| MDL Number | MFCD00134229 |
| Molecular Weight | 171.58 |
| MOL File | 6388-47-2.mol |
Chemical Properties
| Appearance | white to yellow, tan or grey crystalline powder |
| Melting point | 189-191 °C (lit.) |
| Boiling point | 0°C |
| density | 1.476±0.06 g/cm3(Predicted) |
| Fp | 0°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO, Methanaol |
| form | Solid |
| pka | 4.57±0.10(Predicted) |
| color | Yellow to brown |
| Water Solubility | Soluble in water. |
| Sensitive | Air & Light Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6ClNO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1N |
| CAS DataBase Reference | 6388-47-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
