637-01-4
| Name | N,N,N',N'-Tetramethyl-p-phenylenediamine dihydrochloride |
| CAS | 637-01-4 |
| EINECS(EC#) | 211-274-8 |
| Molecular Formula | C10H18Cl2N2 |
| MDL Number | MFCD00012482 |
| Molecular Weight | 237.17 |
| MOL File | 637-01-4.mol |
Chemical Properties
| Appearance | Off white to gray powder |
| Melting point | 222-224 °C(lit.) |
| Boiling point | 378.54°C (rough estimate) |
| density | 1.1961 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Store at RT. |
| solubility | H2O: soluble500mg/10 mL |
| form | powder |
| color | off-white to gray |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility | SOLUBLE |
| Sensitive | Light Sensitive |
| BRN | 5132096 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C10H16N2.ClH/c1-11(2)9-5-7-10(8-6-9)12(3)4;/h5-8H,1-4H3;1H |
| InChIKey | DNRUPOAHVJBDJE-UHFFFAOYSA-N |
| SMILES | N(C1C=CC(N(C)C)=CC=1)(C)C.Cl |
| CAS DataBase Reference | 637-01-4(CAS DataBase Reference) |
| EPA Substance Registry System | 637-01-4(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | Yes |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29215190 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |