
635-65-4
| Name | Bilirubin |
| CAS | 635-65-4 |
| EINECS(EC#) | 211-239-7 |
| Molecular Formula | C33H36N4O6 |
| MDL Number | MFCD00005499 |
| Molecular Weight | 584.66 |
| MOL File | 635-65-4.mol |
Chemical Properties
| Definition | Red coloring matter of bile. Also occurs in blood serum as decomposition product of hemoglobin. |
| Appearance | Light Orange to Deep Redish-Brown Crystalline Solid |
| Melting point | 192 °C |
| Boiling point | 641.7°C (rough estimate) |
| density | 1.2163 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | −20°C |
| solubility | aqueous acid: soluble |
| form | powder |
| pka | 4.62±0.10(Predicted) |
| color | orange |
| Stability: | Stable. Refrigerate. |
| Water Solubility | practically insoluble |
| Sensitive | Light Sensitive |
| Merck | 14,1218 |
| BRN | 74376 |
| Cosmetics Ingredients Functions | CHELATING REDUCING ANTIOXIDANT |
| InChIKey | BPYKTIZUTYGOLE-IFADSCNNSA-N |
| SMILES | CC1=C(C=C)\C(NC1=O)=C\c2[nH]c(Cc3[nH]c(\C=C4/NC(=O)C(C=C)=C4C)c(C)c3CCC(O)=O)c(CCC(O)=O)c2C |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | DU3038000 |
| F | 8 |
| TSCA | Yes |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
