6342-70-7
| Name | Methyl 3-methoxysalicylate |
| CAS | 6342-70-7 |
| EINECS(EC#) | 228-737-5 |
| Molecular Formula | C9H10O4 |
| MDL Number | MFCD00239511 |
| Molecular Weight | 182.17 |
| MOL File | 6342-70-7.mol |
Chemical Properties
| Melting point | 65-68 °C (lit.) |
| Boiling point | 105 °C(Press: 2 Torr) |
| density | 1.216±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.76±0.10(Predicted) |
| color | White to Gray to Red |
| λmax | 320nm(Dioxane)(lit.) |
| InChI | InChI=1S/C9H10O4/c1-12-7-5-3-4-6(8(7)10)9(11)13-2/h3-5,10H,1-2H3 |
| InChIKey | BWRCJLJJIXYLNV-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(OC)=C1O |
| CAS DataBase Reference | 6342-70-7(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
