
6322-56-1
| Name | 4'-Hydroxy-3'-nitroacetophenone |
| CAS | 6322-56-1 |
| Molecular Formula | C8H7NO4 |
| MDL Number | MFCD00017002 |
| Molecular Weight | 181.15 |
| MOL File | 6322-56-1.mol |
Chemical Properties
| Melting point | 132-135 °C(lit.) |
| Boiling point | 314.24°C (rough estimate) |
| density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Dichloromethane, DMSO, Ethyl Acetate |
| form | powder to crystal |
| pka | 5.18±0.14(Predicted) |
| color | Light yellow to Amber to Dark green |
| BRN | 1959078 |
| InChI | 1S/C8H7NO4/c1-5(10)6-2-3-8(11)7(4-6)9(12)13/h2-4,11H,1H3 |
| InChIKey | MMNKVWGVSHRIJL-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 6322-56-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Hydroxy-3-nitroacetophenone(6322-56-1) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |