632-93-9
| Name | DIETHYL 1,4-DIHYDRO-2,4,6-TRIMETHYL-3,5-PYRIDINEDICARBOXYLATE |
| CAS | 632-93-9 |
| EINECS(EC#) | 211-188-0 |
| Molecular Formula | C14H21NO4 |
| MDL Number | MFCD00005950 |
| Molecular Weight | 267.32 |
| MOL File | 632-93-9.mol |
Chemical Properties
| Appearance | almost white crystalline powder |
| Melting point | 130-132 °C(lit.) |
| Boiling point | 410.51°C (rough estimate) |
| density | 1.1116 (rough estimate) |
| refractive index | 1.5280 (estimate) |
| storage temp. | Flammables area |
| solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2); (1:7): 0.125 mg/ml; DMSO: 20 mg/ml; Ethanol: 20 mg/ml |
| form | powder to crystal |
| pka | 3.53±0.70(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C14H21NO4/c1-6-18-13(16)11-8(3)12(14(17)19-7-2)10(5)15-9(11)4/h8,15H,6-7H2,1-5H3 |
| InChIKey | CDVAIHNNWWJFJW-UHFFFAOYSA-N |
| SMILES | C1(C)NC(C)=C(C(OCC)=O)C(C)C=1C(OCC)=O |
| CAS DataBase Reference | 632-93-9(CAS DataBase Reference) |
| EPA Substance Registry System | 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,4,6-trimethyl-, diethyl ester (632-93-9) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | US7979375 |
| TSCA | TSCA listed |
| HS Code | 2933.39.9200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |