
6280-88-2
| Name | 4-Chloro-2-nitrobenzoic acid |
| CAS | 6280-88-2 |
| EINECS(EC#) | 228-483-5 |
| Molecular Formula | C7H4ClNO4 |
| MDL Number | MFCD00007214 |
| Molecular Weight | 201.56 |
| MOL File | 6280-88-2.mol |
Chemical Properties
| Appearance | light yellow to light yellow-green crystalline |
| Melting point | 141-143 °C (lit.) |
| Boiling point | 160.5°C (rough estimate) |
| density | 1.5 |
| refractive index | 1.6000 (estimate) |
| Fp | >100°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 5.3g/l |
| form | powder to crystal |
| pka | 1.97±0.25(Predicted) |
| color | White to Light yellow |
| Water Solubility | 0.53 g/100 mL (15 ºC) |
| BRN | 2051370 |
| InChI | 1S/C7H4ClNO4/c8-4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,(H,10,11) |
| InChIKey | JAHIPDTWWVYVRV-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 6280-88-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-2-nitrobenzoic acid(6280-88-2) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Inactive |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

