
622-75-3
| Name | 1,4-Phenylenediacetonitrile |
| CAS | 622-75-3 |
| EINECS(EC#) | 210-751-8 |
| Molecular Formula | C10H8N2 |
| MDL Number | MFCD00001923 |
| Molecular Weight | 156.18 |
| MOL File | 622-75-3.mol |
Chemical Properties
| Appearance | Light yellow to brown crystalline powder |
| Melting point | 95-99 °C (lit.) |
| Boiling point | 270.42°C (rough estimate) |
| density | 1.1566 (rough estimate) |
| refractive index | 1.6057 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 1866157 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C10H8N2/c11-7-5-9-1-2-10(4-3-9)6-8-12/h1-4H,5-6H2 |
| InChIKey | FUQCKESKNZBNOG-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=C(CC#N)C=C1 |
| CAS DataBase Reference | 622-75-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Benzenediacetonitrile(622-75-3) |
| EPA Substance Registry System | 622-75-3(EPA Substance) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |