
6138-79-0
| Name | Triprolidine hydrochloride |
| CAS | 6138-79-0 |
| EINECS(EC#) | 627-740-2 |
| Molecular Formula | C19H23ClN2 |
| MDL Number | MFCD00150574 |
| Molecular Weight | 314.85 |
| MOL File | 6138-79-0.mol |
Chemical Properties
| Appearance | White crystalline powder |
| Melting point | 115-120°C |
| storage temp. | 2-8°C |
| solubility | alcohol: soluble1 in 1.5 of solvent |
| form | neat |
| color | White to Off-White |
| Stability: | Stable, but discolours in light. Incompatible with strong oxidizing agents. |
| Water Solubility | >=10 g/100 mL at 20 ºC |
| Usage | Triprolidine hydrochloride monohydrate is used as bulk pharmaceutical (antihistaminic). Product Data Sheet |
| Merck | 13,9817 |
| InChI | InChI=1S/C19H22N2.ClH/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21;/h2-3,6-12H,4-5,13-15H2,1H3;1H/b18-11+; |
| InChIKey | WYUYEJNGHIOFOC-NWBUNABESA-N |
| SMILES | C(=C/CN1CCCC1)(\C1=NC=CC=C1)/C1C=CC(C)=CC=1.Cl |
| LogP | 4.223 (est) |
| CAS DataBase Reference | 6138-79-0(CAS DataBase Reference) |
| EPA Substance Registry System | 6138-79-0(EPA Substance) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | UT7658000 |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |