613-92-3
| Name | BENZAMIDOXIME HYDROCHLORIDE |
| CAS | 613-92-3 |
| EINECS(EC#) | 210-361-8 |
| Molecular Formula | C7H9ClN2O |
| MDL Number | MFCD06656049 |
| Molecular Weight | 172.61 |
| MOL File | 613-92-3.mol |
Chemical Properties
| Melting point | 77°C |
| Boiling point | 244℃ |
| density | 1.18 |
| Fp | 102℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 6.85±0.69(Predicted) |
| color | White to Almost white |
| Detection Methods | HPLC,NMR,MS |
| InChI | InChI=1S/C7H8N2O/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H,(H2,8,9) |
| InChIKey | MXOQNVMDKHLYCZ-UHFFFAOYSA-N |
| SMILES | C1(C(NO)=N)=CC=CC=C1 |
| LogP | 1.024 |
| CAS DataBase Reference | 613-92-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | CY6920000 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |