
613-50-3
| Name | 6-NITROQUINOLINE |
| CAS | 613-50-3 |
| EINECS(EC#) | 210-346-6 |
| Molecular Formula | C9H6N2O2 |
| MDL Number | MFCD00006799 |
| Molecular Weight | 174.16 |
| MOL File | 613-50-3.mol |
Chemical Properties
| Appearance | beige to light brown powder |
| Melting point | 151-153 °C(lit.) |
| Boiling point | 305.12°C (rough estimate) |
| density | 1.2190 (estimate) |
| refractive index | 1.6820 (rough estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | powder to crystal |
| pka | 3.24±0.10(Predicted) |
| color | Needles from water or alc |
| BRN | 136138 |
| InChI | InChI=1S/C9H6N2O2/c12-11(13)8-3-4-9-7(6-8)2-1-5-10-9/h1-6H |
| InChIKey | SMHPLBXIVNQFBA-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC([N+]([O-])=O)=CC=2)C=CC=1 |
| CAS DataBase Reference | 613-50-3(CAS DataBase Reference) |
| EPA Substance Registry System | 6-Nitroquinoline (613-50-3) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VC1900000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 |
| Toxicity |