
612-58-8
| Name | 3-Methylquinoline |
| CAS | 612-58-8 |
| EINECS(EC#) | 210-315-7 |
| Molecular Formula | C10H9N |
| MDL Number | MFCD00014661 |
| Molecular Weight | 143.19 |
| MOL File | 612-58-8.mol |
Chemical Properties
| Appearance | colorless to light yellow liquid |
| Melting point | 16-17 °C (lit.) |
| Boiling point | 252-253 °C (lit.) |
| density | 1.069 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | powder to lump to clear liquid |
| pka | 5.17±0.11(Predicted) |
| color | White or Colorless to Light yellow |
| λmax | 318nm(EtOH aq.)(lit.) |
| Detection Methods | HPLC |
| BRN | 110325 |
| InChI | InChI=1S/C10H9N/c1-8-6-9-4-2-3-5-10(9)11-7-8/h2-7H,1H3 |
| InChIKey | DTBDAFLSBDGPEA-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C=C(C)C=1 |
| CAS DataBase Reference | 612-58-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 3-methyl-(612-58-8) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VC0527000 |
| HS Code | 29334900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Carc. 2 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |