612-22-6
| Name | 2-Ethylnitrobenzene |
| CAS | 612-22-6 |
| EINECS(EC#) | 210-299-1 |
| Molecular Formula | C8H9NO2 |
| MDL Number | MFCD00024294 |
| Molecular Weight | 151.16 |
| MOL File | 612-22-6.mol |
Chemical Properties
| Melting point | -13--10 °C(lit.) |
| Boiling point | 172-174 °C18 mm Hg(lit.) |
| density | 1.127 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 228 °F |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| BRN | 1865655 |
| InChI | InChI=1S/C8H9NO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | XAWCLWKTUKMCMO-UHFFFAOYSA-N |
| SMILES | C1(CC)=CC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 612-22-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-ethyl-2-nitro-(612-22-6) |
| EPA Substance Registry System | 612-22-6(EPA Substance) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| HS Code | 2904200090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |