
60940-34-3
| Name | Ebselen |
| CAS | 60940-34-3 |
| EINECS(EC#) | 612-054-8 |
| Molecular Formula | C13H9NOSe |
| MDL Number | MFCD00210937 |
| Molecular Weight | 274.18 |
| MOL File | 60940-34-3.mol |
Chemical Properties
| Description | |
| Appearance | yellow to beige crystalline powder |
| Melting point | 176-182 °C |
| Boiling point | 402.8±28.0 °C(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in ethanol, methanol, acetone, acetonitrile. |
| form | Crystalline Powder |
| pka | -0.40±0.20(Predicted) |
| color | Yellow to beige |
| biological source | rabbit |
| Merck | 14,3486 |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. |
| InChI | InChI=1S/C13H9NOSe/c15-13-11-8-4-5-9-12(11)16-14(13)10-6-2-1-3-7-10/h1-9H |
| InChIKey | DYEFUKCXAQOFHX-UHFFFAOYSA-N |
| SMILES | [Se]1C2=C(C=CC=C2)C(=O)N1C1=CC=CC=C1 |
| Uses | |
| CAS DataBase Reference | 60940-34-3(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T,N,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3283 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DE4140750 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |