
607-35-2
| Name | 8-Nitroquinoline |
| CAS | 607-35-2 |
| EINECS(EC#) | 210-135-9 |
| Molecular Formula | C9H6N2O2 |
| MDL Number | MFCD00006806 |
| Molecular Weight | 174.16 |
| MOL File | 607-35-2.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 89-91 °C (lit.) |
| Boiling point | 305.12°C (rough estimate) |
| density | 1.2190 (estimate) |
| refractive index | 1.6820 (rough estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.20±0.17(Predicted) |
| color | Monoclinic crystals from alcohol |
| Water Solubility | Soluble in ethanol, ethyl ether and benzene, slightly soluble in cold water. |
| BRN | 135178 |
| InChI | InChI=1S/C9H6N2O2/c12-11(13)8-5-1-3-7-4-2-6-10-9(7)8/h1-6H |
| InChIKey | OQHHSGRZCKGLCY-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2[N+]([O-])=O)C=CC=1 |
| CAS DataBase Reference | 607-35-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 8-Nitro quinoline(607-35-2) |
| EPA Substance Registry System | 607-35-2(EPA Substance) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VC1925000 |
| Hazard Note | Harmful/Irritant |
| TSCA | Yes |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 607-35-2(Hazardous Substances Data) |
| Toxicity |