
607-34-1
| Name | 5-Nitroquinoline |
| CAS | 607-34-1 |
| EINECS(EC#) | 210-134-3 |
| Molecular Formula | C9H6N2O2 |
| MDL Number | MFCD00006790 |
| Molecular Weight | 174.16 |
| MOL File | 607-34-1.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 71-73 °C (lit.) |
| Boiling point | 70-73°C |
| density | 1.2190 (estimate) |
| refractive index | 1.6820 (rough estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | powder to crystal |
| pka | 2.80±0.12(Predicted) |
| color | Plates from EtOH (aq) |
| Detection Methods | HPLC |
| InChI | InChI=1S/C9H6N2O2/c12-11(13)9-5-1-4-8-7(9)3-2-6-10-8/h1-6H |
| InChIKey | NDDZXHOCOKCNBM-UHFFFAOYSA-N |
| SMILES | N1C2C(=C([N+]([O-])=O)C=CC=2)C=CC=1 |
| CAS DataBase Reference | 607-34-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 5-nitro-(607-34-1) |
| Storage Precautions | Moisture sensitive;Heat sensitive |
| EPA Substance Registry System | 607-34-1(EPA Substance) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VC1850000 |
| Hazard Note | Irritant |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 |
| Toxicity |