
6055-19-2
| Name | Cyclophosphamide monohydrate |
| CAS | 6055-19-2 |
| EINECS(EC#) | 200-015-4 |
| Molecular Formula | C7H17Cl2N2O3P |
| MDL Number | MFCD00149395 |
| Molecular Weight | 279.1 |
| MOL File | 6055-19-2.mol |
Chemical Properties
| Appearance | White to Off-White Solid |
| Melting point | 49-51 °C (lit.) |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Crystals or Crystalline Powder |
| color | White to almost white |
| Water Solubility | 40 g/L |
| Usage | It is a cytotoxic nitrogen mustard derivative widely used in cancer chemotherapy. It cross-links DNA, causes strand breakage, and induces mutations. Its clinical activity is associated with a decrease in aldehyde dehydrogenase 1 (ALDH1) activity. Th |
| Merck | 14,2747 |
| BRN | 8167897 |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology veterinary |
| InChI | InChI=1S/C7H15Cl2N2O2P.H2O/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14;/h1-7H2,(H,10,12);1H2 |
| InChIKey | PWOQRKCAHTVFLB-UHFFFAOYSA-N |
| SMILES | P1(=O)(OCCCN1)N(CCCl)CCCl.O |
| CAS DataBase Reference | 6055-19-2(CAS DataBase Reference) |
| IARC | 1 (Vol. 26, Sup 7, 100A) 2012 |
| EPA Substance Registry System | 6055-19-2(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H340-H350-H360FD |
| Precautionary statements | P202-P264-P270-P280-P301+P310-P405 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3464 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | RP6157750 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 1B Muta. 1B Repr. 1A |
| Safety Profile |

