605-91-4
| Name | 1,1'-DIETHYL-2,2'-CARBOCYANINE IODIDE |
| CAS | 605-91-4 |
| EINECS(EC#) | 210-099-4 |
| Molecular Formula | C25H25IN2 |
| MDL Number | MFCD00011975 |
| Molecular Weight | 480.38 |
| MOL File | 605-91-4.mol |
Chemical Properties
| Melting point | 295 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | ethanol: 10mg/mL |
| form | powder to crystal |
| color | Green to Dark green |
| ε(extinction coefficient) | ≥180000 at 602-608nm in ethanol ≥80000 at 560-566nm in ethanol |
| λmax | 614 nm |
| BRN | 4117070 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C25H25N2.HI/c1-3-26-22(18-16-20-10-5-7-14-24(20)26)12-9-13-23-19-17-21-11-6-8-15-25(21)27(23)4-2;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QWYZFXLSWMXLDM-UHFFFAOYSA-M |
| SMILES | [I-].CCN1\C(=C\C=C\c2ccc3ccccc3[n+]2CC)C=Cc4ccccc14 |
| CAS DataBase Reference | 605-91-4(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | VC3676870 |
| HS Code | 2933.49.7000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral |