
603-79-2
| Name | 2,3-Dimethylbenzoic acid |
| CAS | 603-79-2 |
| EINECS(EC#) | 210-058-0 |
| Molecular Formula | C9H10O2 |
| MDL Number | MFCD00002479 |
| Molecular Weight | 150.17 |
| MOL File | 603-79-2.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 144-146 °C (lit.) |
| Boiling point | 271.51°C (estimate) |
| density | 1.0937 (estimate) |
| refractive index | 1.5188 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | pKa: 3.771(25°C) |
| color | White to Almost white |
| BRN | 971590 |
| InChI | InChI=1S/C9H10O2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | RIZUCYSQUWMQLX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(C)=C1C |
| CAS DataBase Reference | 603-79-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2,3-dimethyl-(603-79-2) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DG8734000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
