
603-50-9
| Name | Bisacodyl |
| CAS | 603-50-9 |
| EINECS(EC#) | 210-044-4 |
| Molecular Formula | C22H19NO4 |
| MDL Number | MFCD00038039 |
| Molecular Weight | 361.39 |
| MOL File | 603-50-9.mol |
Chemical Properties
| Appearance | Crystalline Solid |
| Melting point | 138°C |
| Boiling point | 493.21°C (rough estimate) |
| density | 1.2545 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, soluble in acetone, sparingly soluble in ethanol (96 per cent). It dissolves in dilute mineral acids. |
| form | neat |
| pka | 4.69±0.10(Predicted) |
| color | White to Off-White |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | Soluble in alcohol (slightly), ether (slightly), chloroform, and acetone. Insoluble in water. |
| Usage | Cathartic. |
| λmax | 220nm(MeOH)(lit.) |
| Merck | 14,1242 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C22H19NO4/c1-15(24)26-19-10-6-17(7-11-19)22(21-5-3-4-14-23-21)18-8-12-20(13-9-18)27-16(2)25/h3-14,22H,1-2H3 |
| InChIKey | KHOITXIGCFIULA-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(cc1)C(c2ccc(OC(C)=O)cc2)c3ccccn3 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | SM8750000 |
| TSCA | Yes |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 603-50-9(Hazardous Substances Data) |
| Toxicity |
