
60238-56-4
| Name | CHLORTHIOPHOS |
| CAS | 60238-56-4 |
| EINECS(EC#) | 684-828-3 |
| Molecular Formula | C11H15Cl2O3PS2 |
| MDL Number | MFCD00143963 |
| Molecular Weight | 361.24 |
| MOL File | 60238-56-4.mol |
Chemical Properties
| Appearance | Chlorthiophos is a yellowish-brown liquid. boiling point = 153-158°C @ 13 mmHg, and crystallizes at less than 25°C. Hazard identification (based on NFPA-704 M Rating System): Health 3, flammability 1, reactivity 0 |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | neat |
| color | Off-White |
| BRN | 2006212 |
| Major Application | agriculture environmental |
| InChI | 1S/C11H15Cl2O3PS2/c1-4-14-17(18,15-5-2)16-10-6-9(13)11(19-3)7-8(10)12/h6-7H,4-5H2,1-3H3 |
| InChIKey | JAZJVWLGNLCNDD-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1cc(Cl)c(SC)cc1Cl |
| EPA Substance Registry System | Chlorthiophos (60238-56-4) |
Safety Data
| Hazard Codes | T+,N,F+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TF0185000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29309090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Oral Aquatic Acute 1 |