5930-28-9
| Name | 4-Amino-2,6-dichlorophenol |
| CAS | 5930-28-9 |
| EINECS(EC#) | 227-671-4 |
| Molecular Formula | C6H5Cl2NO |
| MDL Number | MFCD00007875 |
| Molecular Weight | 178.02 |
| MOL File | 5930-28-9.mol |
Chemical Properties
| Appearance | solid |
| Melting point | 167-170 °C (lit.) |
| Boiling point | 303.6±42.0 °C(Predicted) |
| density | 1.2549 (rough estimate) |
| refractive index | 1.5680 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 7.29±0.23(Predicted) |
| color | Beige or slightly brown to pale reddish |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. |
| BRN | 2361665 |
| InChI | InChI=1S/C6H5Cl2NO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H,9H2 |
| InChIKey | KGEXISHTCZHGFT-UHFFFAOYSA-N |
| SMILES | C1(O)=C(Cl)C=C(N)C=C1Cl |
| CAS DataBase Reference | 5930-28-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-amino-2,6-dichloro-(5930-28-9) |
| EPA Substance Registry System | 5930-28-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | SJ5774500 |
| TSCA | Yes |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |