59016-56-7
| Name | CDAP |
| CAS | 59016-56-7 |
| Molecular Formula | C8H10BF4N3 |
| MDL Number | MFCD00011998 |
| Molecular Weight | 234.99 |
| MOL File | 59016-56-7.mol |
Chemical Properties
| Appearance | White to yellow powder |
| Melting point | 196-200°C |
| storage temp. | 2-8°C |
| form | Powder |
| color | White to yellow |
| biological source | synthetic |
| Water Solubility | Soluble in water, and acetonitrile. |
| λmax | 301nm(CH3CN)(lit.) |
| BRN | 5685616 |
| InChI | InChI=1S/C8H10N3.BF4/c1-10(2)8-3-5-11(7-9)6-4-8;2-1(3,4)5/h3-6H,1-2H3;/q+1;-1 |
| InChIKey | MBLVMDCQDCVKNE-UHFFFAOYSA-N |
| SMILES | [B+3]([F-])([F-])([F-])[F-].N(C1=CC=[N+](C#N)C=C1)(C)C |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 3-8-10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 |