590-97-6
| Name | BROMOMETHYL ACETATE |
| CAS | 590-97-6 |
| EINECS(EC#) | 209-696-2 |
| Molecular Formula | C3H5BrO2 |
| MDL Number | MFCD00000170 |
| Molecular Weight | 152.97 |
| MOL File | 590-97-6.mol |
Chemical Properties
| Appearance | Clear colorless to yellow liquid |
| Melting point | 139-140.5 °C |
| Boiling point | 130-133 °C/750 mmHg (lit.) |
| density | 1.56 g/mL at 25 °C(lit.) |
| refractive index | n |
| RTECS | AF6300200 |
| Fp | 135 °F |
| storage temp. | 2-8°C |
| solubility | Miscible with chloroform. |
| form | Crystalline Powder or Powder |
| color | White to light beige |
| Sensitive | Moisture Sensitive |
| Usage | Has cytotoxicity and mutagenicity effects. |
| Stability: | Hygroscopic, Moisture Sensitive, Volatile |
| InChI | InChI=1S/C3H5BrO2/c1-3(5)6-2-4/h2H2,1H3 |
| InChIKey | NHYXMAKLBXBVEO-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)Br |
| CAS DataBase Reference | 590-97-6(CAS DataBase Reference) |
| EPA Substance Registry System | Methanol, bromo-, acetate (590-97-6) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29153900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |