| Appearance |
Light, off-white powder, p H of solution
3.5. Slightly soluble in cold water; soluble in hot
water, acid, or alkaline solutions. Combustible.
|
| Melting point |
188 °C (dec.)(lit.) |
| storage temp. |
Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility |
DMSO (Slightly, Heated, Sonicated), Water (Slightly, Sonicated) |
| form |
Solid |
| color |
White to Off-White |
| Water Solubility |
Water : 31.25 mg/mL (125.89 mM; ultrasonic and warming and heat to 60°C) |
| Stability: |
Hygroscopic |
| InChI |
InChI=1/C6H10O8.K.H/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;;/h1-4,7-10H,(H,11,12)(H,13,14);;/t1-,2-,3-,4+;;/s3 |
| InChIKey |
GAVCDSZEBZVUNJ-SRGBMTMUNA-N |
| SMILES |
[C@@H](O)([C@@H](O)C(=O)O)[C@H](O)[C@H](O)C(=O)O.[KH] |&1:0,2,7,9,r| |
| Uses |
Chelating agent, rubber formulations, metal
plating, soaps, and detergents.
|
| CAS DataBase Reference |
576-42-1(CAS DataBase Reference) |