
5653-40-7
| Name | 2-Amino-4,5-dimethoxybenzoic acid |
| CAS | 5653-40-7 |
| EINECS(EC#) | 227-095-3 |
| Molecular Formula | C9H11NO4 |
| MDL Number | MFCD00011671 |
| Molecular Weight | 197.19 |
| MOL File | 5653-40-7.mol |
Chemical Properties
| Appearance | Brown Solid |
| Melting point | 169-173 °C (dec.) (lit.) |
| Boiling point | 334.28°C (rough estimate) |
| density | 1.3075 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetontrile (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 2.35±0.10(Predicted) |
| color | White, beige, or gray to brown |
| Water Solubility | Soluble in Methanol and Water |
| BRN | 782814 |
| Stability: | May be Sensitive To Air Oxidation, Light Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C9H11NO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,10H2,1-2H3,(H,11,12) |
| InChIKey | HJVAVGOPTDJYOJ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(OC)=C(OC)C=C1N |
| CAS DataBase Reference | 5653-40-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
