55700-44-2
| Name | (R)-N,N-DIMETHYL-1-[(S)-2-(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE |
| CAS | 55700-44-2 |
| EINECS(EC#) | 633-502-9 |
| Molecular Formula | C26H28FeNP 10* |
| MDL Number | MFCD00075286 |
| Molecular Weight | 441.33 |
| MOL File | 55700-44-2.mol |
Chemical Properties
| Melting point | 141-143 °C(lit.) |
| alpha | -355 º (C=0.6 IN ETOH) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | solid |
| color | Light yellow to Yellow to Orange |
| Optical Rotation | [α]20/D 355°, c = 0.6 in ethanol |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | 1S/C21H23NP.C5H5.Fe/c1-17(22(2)3)20-15-10-16-21(20)23(18-11-6-4-7-12-18)19-13-8-5-9-14-19;1-2-4-5-3-1;/h4-17H,1-3H3;1-5H;/t17-;;/m1../s1 |
| InChIKey | RCAFPSZHKFOLEE-ZEECNFPPSA-N |
| SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.C[C@H]([C]2[CH][CH][CH][C]2P(c3ccccc3)c4ccccc4)N(C)C |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3288 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |