
5543-57-7
| Name | (S)-(-)-WARFARIN |
| CAS | 5543-57-7 |
| EINECS(EC#) | 226-907-3 |
| Molecular Formula | C19H16O4 |
| MDL Number | MFCD00272381 |
| Molecular Weight | 308.33 |
| MOL File | 5543-57-7.mol |
Chemical Properties
| Melting point | ≥170 °C |
| storage temp. | 2-8°C |
| solubility | DMF: 25 mg/ml; DMSO: 25 mg/ml; Ethanol: 5 mg/ml |
| form | A crystalline solid |
| color | white to pale yellow |
| InChI | 1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3/t15-/m0/s1 |
| InChIKey | PJVWKTKQMONHTI-HNNXBMFYSA-N |
| SMILES | [H][C@](CC(C)=O)(c1ccccc1)C2=C(O)c3ccccc3OC2=O |
| CAS DataBase Reference | 5543-57-7(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 Repr. 1A STOT RE 1 |