
53188-07-1
| Name | 6-HYDROXY-2,5,7,8-TETRAMETHYLCHROMAN-2-CARBOXYLIC ACID |
| CAS | 53188-07-1 |
| EINECS(EC#) | 258-422-8 |
| Molecular Formula | C14H18O4 |
| MDL Number | MFCD00006846 |
| Molecular Weight | 250.29 |
| MOL File | 53188-07-1.mol |
Chemical Properties
| Appearance | white to fainly beige crystalline powder |
| Melting point | 187-189 °C (lit.) |
| Boiling point | 313.42°C (rough estimate) |
| density | 1.0616 (rough estimate) |
| refractive index | 1.4970 (estimate) |
| storage temp. | 0-6°C |
| solubility | Soluble in DMSO (up to 25 mg/ml) or in Ethanol (up to 25 mg/ml). Also soluble in Water at alkalinepH. |
| form | Crystalline Powder |
| pka | 3.35±0.20(Predicted) |
| color | White to faintly beige |
| Water Solubility | water: 0.5mg/mL (slightly soluble) ethanol: 150mg/mL methanol: soluble |
| BRN | 1384051 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 1 month. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C14H18O4/c1-7-8(2)12-10(9(3)11(7)15)5-6-14(4,18-12)13(16)17/h15H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | GLEVLJDDWXEYCO-UHFFFAOYSA-N |
| SMILES | C1(C)(C(O)=O)OC2=C(C)C(C)=C(O)C(C)=C2CC1 |
| CAS DataBase Reference | 53188-07-1(CAS DataBase Reference) |
| EPA Substance Registry System | 3,4-Dihydro-6-hydroxy-2,5,7,8-tetramethyl-2H-1-benzopyran-2-carboxylic acid (53188-07-1) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | DJ2273000 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
