5300-03-8
| Name | 9-CIS-RETINOIC ACID |
| CAS | 5300-03-8 |
| EINECS(EC#) | 1533716-785-6 |
| Molecular Formula | C20H28O2 |
| MDL Number | MFCD00270072 |
| Molecular Weight | 300.44 |
| MOL File | 5300-03-8.mol |
Chemical Properties
| Appearance | Pale Yellow Solid |
| Melting point | 189-191°C |
| Boiling point | 462.8±14.0 °C(Predicted) |
| density | 1.011±0.06 g/cm3(Predicted) |
| RTECS | VH6450000 |
| storage temp. | −20°C |
| solubility | Acetonitrile (Very Slightly), Chloroform (Slightly), DMSO (Slightly), Ethanol ( |
| form | Light yellow to orange crystalline powder. |
| pka | 4.73±0.33(Predicted) |
| color | Pale Yellow to Yellow |
| biological source | natural |
| Water Solubility | Soluble in chloroform (50 mg/ml), DMSO (~25 mg/ml), ethanol (25 mg/ml), and acetone (25 mg/ml). Insoluble in water. |
| Sensitive | Moisture & Light Sensitive |
| Usage | An endogenous retinoic acid isomer, which is capable of binding to both retinoic acid receptors (RAR) and retinoid X receptors (RXR). A biologically active ligand for members of the RAR and RXR subfamilies, implying that it may play a critical rol |
| Stability: | Store Dry in Freezer at -20°C for up to 1 year; in Solution at -20°C for up to 3 Months. |
| InChI | InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12-11+,15-8-,16-14+ |
| InChIKey | SHGAZHPCJJPHSC-ZVCIMWCZSA-N |
| SMILES | C(O)(=O)/C=C(/C=C/C=C(\C=C\C1C(C)(C)CCCC=1C)/C)\C |
| CAS DataBase Reference | 5300-03-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29162090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 5300-03-8(Hazardous Substances Data) |