51387-90-7
| Name | 2-(2-Aminoethyl)-1-methylpyrrolidine |
| CAS | 51387-90-7 |
| EINECS(EC#) | 257-169-0 |
| Molecular Formula | C7H16N2 |
| MDL Number | MFCD00003175 |
| Molecular Weight | 128.22 |
| MOL File | 51387-90-7.mol |
Chemical Properties
| Appearance | Clear colorless to pale yellow liquid |
| Boiling point | 152.7±8.0 °C(Predicted) |
| density | 0.885 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 149 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 10.34±0.40(Predicted) |
| color | Light beige to light brown |
| InChI | InChI=1S/C7H16N2/c1-9-6-2-3-7(9)4-5-8/h7H,2-6,8H2,1H3 |
| InChIKey | PNHGJPJOMCXSKN-UHFFFAOYSA-N |
| SMILES | N1(C)CCCC1CCN |
| CAS DataBase Reference | 51387-90-7(CAS DataBase Reference) |
| Storage Precautions | Air sensitive;Store under inert gas;Moisture sensitive |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2735 |
| WGK Germany | 2 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |