
51050-59-0
| Name | 3,4-DICHLOROISOCOUMARIN |
| CAS | 51050-59-0 |
| Molecular Formula | C9H4Cl2O2 |
| MDL Number | MFCD00036960 |
| Molecular Weight | 215.03 |
| MOL File | 51050-59-0.mol |
Chemical Properties
| Boiling point | 304.7±42.0 °C(Predicted) |
| density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMF or DMSO at a concentration of 10mM |
| form | White lyophilized solid |
| color | White to off-white |
| BRN | 6802625 |
| InChI | 1S/C9H4Cl2O2/c10-7-5-3-1-2-4-6(5)9(12)13-8(7)11/h1-4H |
| InChIKey | SUGXUUGGLDCZKB-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)c2ccccc2C(=O)O1 |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
