51-12-7
| Name | NIALAMIDE |
| CAS | 51-12-7 |
| EINECS(EC#) | 200-079-3 |
| Molecular Formula | C16H18N4O2 |
| MDL Number | MFCD00010106 |
| Molecular Weight | 298.34 |
| MOL File | 51-12-7.mol |
Chemical Properties
| Appearance | White, crystalline powder. Low solubility in water; good solubility in slightly acid solution. It is stable in crystalline form, suspension, and solution. |
| Melting point | 152-154 °C(lit.) |
| Boiling point | 439.76°C (rough estimate) |
| density | 1.1183 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | −20°C |
| solubility | ethanol: clear to hazy |
| form | Solid |
| pka | 11.13±0.23(Predicted) |
| color | White to off-white |
| Merck | 13,6515 |
| BRN | 492941 |
| InChI | 1S/C16H18N4O2/c21-15(18-12-13-4-2-1-3-5-13)8-11-19-20-16(22)14-6-9-17-10-7-14/h1-7,9-10,19H,8,11-12H2,(H,18,21)(H,20,22) |
| InChIKey | NOIIUHRQUVNIDD-UHFFFAOYSA-N |
| SMILES | O=C(CCNNC(=O)c1ccncc1)NCc2ccccc2 |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | NS1225000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 51-12-7(Hazardous Substances Data) |
| Toxicity |