
500-66-3
| Name | Olivetol |
| CAS | 500-66-3 |
| EINECS(EC#) | 207-908-8 |
| Molecular Formula | C11H16O2 |
| MDL Number | MFCD00002293 |
| Molecular Weight | 180.24 |
| MOL File | 500-66-3.mol |
Chemical Properties
| Appearance | light purple to brown crystalline mass |
| Melting point | 46-48 °C(lit.) |
| Boiling point | 164 °C |
| density | 1.068±0.06 g/cm3(Predicted) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.59±0.10(Predicted) |
| color | Colourless to Beige Oil to Low-Melting |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C11H16O2/c1-2-3-4-5-9-6-10(12)8-11(13)7-9/h6-8,12-13H,2-5H2,1H3 |
| InChIKey | IRMPFYJSHJGOPE-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(CCCCC)=CC(O)=C1 |
| Uses | |
| CAS DataBase Reference | 500-66-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Benzenediol, 5-pentyl-(500-66-3) |
| EPA Substance Registry System | 500-66-3(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VH2880000 |
| HS Code | 2907290090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 3 Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1B STOT SE 1 Oral STOT SE 2 Oral |


