
4892-02-8
| Name | METHYL THIOSALICYLATE |
| CAS | 4892-02-8 |
| EINECS(EC#) | 628-716-4 |
| Molecular Formula | C8H8O2S |
| MDL Number | MFCD00060678 |
| Molecular Weight | 168.21 |
| MOL File | 4892-02-8.mol |
Chemical Properties
| Appearance | clear colorless to light yellow or light green |
| Melting point | 164 °C |
| Boiling point | 98-100 °C/2 mmHg (lit.) |
| density | 1.223 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 5.84±0.43(Predicted) |
| color | Clear colorless to light yellow or light green |
| Specific Gravity | 1.223 |
| Sensitive | Air Sensitive |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C8H8O2S/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5,11H,1H3 |
| InChIKey | BAQGCWNPCFABAY-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1S |
| CAS DataBase Reference | 4892-02-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DH3500000 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |