462-34-0
| Name | Boron trifluoride tetrahydrofuran complex |
| CAS | 462-34-0 |
| EINECS(EC#) | 207-325-9 |
| Molecular Formula | C4H8BF3O |
| MDL Number | MFCD00040372 |
| Molecular Weight | 139.91 |
| MOL File | 462-34-0.mol |
Chemical Properties
| Appearance | Colorless to light yellow liqui |
| Melting point | 11-13 °C (lit.) |
| Boiling point | 180 °C (lit.) |
| density | 1.268 g/mL at 25 °C(lit.) |
| vapor pressure | 11Pa |
| Fp | 198 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with dimethyl formamide. |
| form | liquid |
| explosive limit | 2.3-17.7%(V) |
| Water Solubility | hydrolysis |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C4H8BF3O/c6-5(7,8)9-3-1-2-4-9/h1-4H2 |
| InChIKey | XYMZNNGTHKHCJH-UHFFFAOYSA-N |
| SMILES | [B+3](O1CCCC1)([F-])([F-])[F-] |
| CAS DataBase Reference | 462-34-0(CAS DataBase Reference) |
| EPA Substance Registry System | 462-34-0(EPA Substance) |
Safety Data
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H314-H373 |
| Precautionary statements | P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338-P314 |
| Hazard Codes | C,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 1 |
| Hazard Note | Toxic/Corrosive |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29321900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B STOT RE 1 Inhalation |