46004-37-9
| Name | Methyl 4-amino-2-chlorobenzoate |
| CAS | 46004-37-9 |
| Molecular Formula | C8H8ClNO2 |
| MDL Number | MFCD03840484 |
| Molecular Weight | 185.61 |
| MOL File | 46004-37-9.mol |
Chemical Properties
| Melting point | 112-114°C |
| Boiling point | 334.2±22.0 °C(Predicted) |
| density | 1.311±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| pka | 1.41±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H8ClNO2/c1-12-8(11)6-3-2-5(10)4-7(6)9/h2-4H,10H2,1H3 |
| InChIKey | DSHBGNPOIBSIOQ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(N)C=C1Cl |
| CAS DataBase Reference | 46004-37-9(CAS DataBase Reference) |