459-32-5
| Name | 4-Fluorocinnamic acid |
| CAS | 459-32-5 |
| EINECS(EC#) | 207-288-9 |
| Molecular Formula | C9H7FO2 |
| MDL Number | MFCD00004395 |
| Molecular Weight | 166.15 |
| MOL File | 459-32-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 209-210 °C (lit.) |
| Boiling point | 290°C (rough estimate) |
| density | 1.2247 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Solid |
| pka | 4.43±0.10(Predicted) |
| color | White to off-white |
| BRN | 2613441 |
| InChI | InChI=1S/C9H7FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12) |
| InChIKey | ISMMYAZSUSYVQG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(F)C=C1 |
| CAS DataBase Reference | 459-32-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluorocinnamic acid(459-32-5) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
