4548-53-2
| Name | PONCEAU SX |
| CAS | 4548-53-2 |
| EINECS(EC#) | 224-909-9 |
| Molecular Formula | C18H14N2Na2O7S2 |
| MDL Number | MFCD00046402 |
| Molecular Weight | 480.42 |
| MOL File | 4548-53-2.mol |
Chemical Properties
| Melting point | >300℃ |
| density | 0.272[at 20℃] |
| solubility | Soluble in water, ethanol |
| Colour Index | 14700 |
| form | crystals |
| color | Red |
| Water Solubility | 130.4g/L at 30℃ |
| λmax | 500 nm |
| Merck | 7591 |
| BRN | 7161700 |
| Biological Applications | Detecting proteins; treating acquired resistance to GABAergic (ARG) agents; Shampoos; soaps |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChIKey | ONTQJDKFANPPKK-LLIZZRELSA-L |
| SMILES | [Na+].[Na+].Cc1cc(C)c(cc1\N=N\c2cc(c3ccccc3c2O)S([O-])(=O)=O)S([O-])(=O)=O |
| LogP | -0.083 |
| CAS DataBase Reference | 4548-53-2(CAS DataBase Reference) |
| IARC | 3 (Vol. 8, Sup 7) 1987 |
| EPA Substance Registry System | C.I. Food Red 1, disodium salt (4548-53-2) |